C54H36N2OSi — CID 164756707
[9-(9-dibenzofuran-2-ylcarbazol-3-yl)carbazol-4-yl]-(2,3,4,5,6-pentadeuteriophenyl)-diphenylsilane (PubChem CID 164756707) has the molecular formula C54H36N2OSi and a molecular weight of 762.01 g/mol. Its IUPAC name is [9-(9-dibenzofuran-2-ylcarbazol-3-yl)carbazol-4-yl]-(2,3,4,5,6-pentadeuteriophenyl)-diphenylsilane.
| Compound Name | [9-(9-dibenzofuran-2-ylcarbazol-3-yl)carbazol-4-yl]-(2,3,4,5,6-pentadeuteriophenyl)-diphenylsilane |
|---|---|
| PubChem CID | 164756707 |
| Molecular Formula | C54H36N2OSi |
| Molecular Weight | 762.01 g/mol |
| Exact Mass | 761.29 |
| IUPAC Name | [9-(9-dibenzofuran-2-ylcarbazol-3-yl)carbazol-4-yl]-(2,3,4,5,6-pentadeuteriophenyl)-diphenylsilane |
| SMILES | [2H]c1c([2H])c([2H])c([Si](c2ccccc2)(c2ccccc2)c2cccc3c2c2ccccc2n3-c2ccc3c(c2)c2ccccc2n3-c2ccc3oc4ccccc4c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C54H36N2OSi/c1-4-17-39(18-5-1)58(40-19-6-2-7-20-40,41-21-8-3-9-22-41)53-30-16-28-50-54(53)44-25-11-14-27-48(44)56(50)37-31-33-49-45(35-37)42-23-10-13-26-47(42)55(49)38-32-34-52-46(36-38)43-24-12-15-29-51(43)57-52/h1-36H/i1D,4D,5D,17D,18D |
| InChIKey | NEMZTRQTCSKHRL-OCAOJUBNSA-N |
| XLogP | 11.16 |
| TPSA | 23.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.01 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|