C54H36N3Na-2 — CID 164757261
sodium;4-carbazol-9-yl-N-(4-carbazol-9-ylphenyl)-N-phenylaniline;phenylbenzene (PubChem CID 164757261) has the molecular formula C54H36N3Na-2 and a molecular weight of 749.89 g/mol. Its IUPAC name is sodium;4-carbazol-9-yl-N-(4-carbazol-9-ylphenyl)-N-phenylaniline;phenylbenzene.
| Compound Name | sodium;4-carbazol-9-yl-N-(4-carbazol-9-ylphenyl)-N-phenylaniline;phenylbenzene |
|---|---|
| PubChem CID | 164757261 |
| Molecular Formula | C54H36N3Na-2 |
| Molecular Weight | 749.89 g/mol |
| Exact Mass | 749.28 |
| IUPAC Name | sodium;4-carbazol-9-yl-N-(4-carbazol-9-ylphenyl)-N-phenylaniline;phenylbenzene |
| SMILES | [Na+].[c-]1ccc(N(c2ccc(-n3c4ccccc4c4ccccc43)cc2)c2ccc(-n3c4ccccc4c4ccccc43)cc2)cc1.[c-]1ccccc1-c1[c-]cccc1 |
| InChI | InChI=1S/C42H28N3.C12H8.Na/c1-2-12-30(13-3-1)43(31-22-26-33(27-23-31)44-39-18-8-4-14-35(39)36-15-5-9-19-40(36)44)32-24-28-34(29-25-32)45-41-20-10-6-16-37(41)38-17-7-11-21-42(38)45;1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h2-29H;1-7,9H;/q-1;-2;+1 |
| InChIKey | INSHUJABKJIDHM-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.89 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|