C13H8BrN5O — CID 164757515
6-[3-(2-aminoethynyl)phenyl]-2-bromo-7H-[1,2,4]triazolo[1,5-a]pyrazin-8-one (PubChem CID 164757515) has the molecular formula C13H8BrN5O and a molecular weight of 330.15 g/mol. Its IUPAC name is 6-[3-(2-aminoethynyl)phenyl]-2-bromo-7H-[1,2,4]triazolo[1,5-a]pyrazin-8-one.
| Compound Name | 6-[3-(2-aminoethynyl)phenyl]-2-bromo-7H-[1,2,4]triazolo[1,5-a]pyrazin-8-one |
|---|---|
| PubChem CID | 164757515 |
| Molecular Formula | C13H8BrN5O |
| Molecular Weight | 330.15 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 6-[3-(2-aminoethynyl)phenyl]-2-bromo-7H-[1,2,4]triazolo[1,5-a]pyrazin-8-one |
| SMILES | NC#Cc1cccc(-c2cn3nc(Br)nc3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C13H8BrN5O/c14-13-17-11-12(20)16-10(7-19(11)18-13)9-3-1-2-8(6-9)4-5-15/h1-3,6-7H,15H2,(H,16,20) |
| InChIKey | XBRLTLUDNXFVHL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.15 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|