About 6-amino-3,5-di(propan-2-yl)-1,6-dihydropyrimidin-2-one
6-amino-3,5-di(propan-2-yl)-1,6-dihydropyrimidin-2-one (PubChem CID 164758401) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is 6-amino-3,5-di(propan-2-yl)-1,6-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | 6-amino-3,5-di(propan-2-yl)-1,6-dihydropyrimidin-2-one |
| PubChem CID | 164758401 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 6-amino-3,5-di(propan-2-yl)-1,6-dihydropyrimidin-2-one |
| SMILES | CC(C)C1=CN(C(C)C)C(=O)NC1N |
| InChI | InChI=1S/C10H19N3O/c1-6(2)8-5-13(7(3)4)10(14)12-9(8)11/h5-7,9H,11H2,1-4H3,(H,12,14) |
| InChIKey | OCBMLDNBVXTWKE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-amino-3,5-di(propan-2-yl)-1,6-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3,5-di(propan-2-yl)-1,6-dihydropyrimidin-2-one?
The IUPAC name of 6-amino-3,5-di(propan-2-yl)-1,6-dihydropyrimidin-2-one (CID 164758401) is 6-amino-3,5-di(propan-2-yl)-1,6-dihydropyrimidin-2-one.
What is the SMILES notation for 6-amino-3,5-di(propan-2-yl)-1,6-dihydropyrimidin-2-one?
The canonical SMILES for 6-amino-3,5-di(propan-2-yl)-1,6-dihydropyrimidin-2-one is CC(C)C1=CN(C(C)C)C(=O)NC1N.
What is the InChIKey of 6-amino-3,5-di(propan-2-yl)-1,6-dihydropyrimidin-2-one?
The InChIKey is OCBMLDNBVXTWKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O/c1-6(2)8-5-13(7(3)4)10(14)12-9(8)11/h5-7,9H,11H2,1-4H3,(H,12,14).
What are the key properties of 6-amino-3,5-di(propan-2-yl)-1,6-dihydropyrimidin-2-one?
6-amino-3,5-di(propan-2-yl)-1,6-dihydropyrimidin-2-one has a molecular weight of 197.28 g/mol, XLogP of 1.24, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3,5-di(propan-2-yl)-1,6-dihydropyrimidin-2-one is sourced from PubChem (CID 164758401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).