C48H31N3O2 — CID 164758672
2-[18-(2-isocyanophenyl)-10,10-dimethyl-14-oxo-7-(N-phenylanilino)-21-oxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),4(9),5,7,12,15,17,19-nonaen-16-yl]benzonitrile (PubChem CID 164758672) has the molecular formula C48H31N3O2 and a molecular weight of 681.80 g/mol. Its IUPAC name is 2-[18-(2-isocyanophenyl)-10,10-dimethyl-14-oxo-7-(N-phenylanilino)-21-oxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),4(9),5,7,12,15,17,19-nonaen-16-yl]benzonitrile.
| Compound Name | 2-[18-(2-isocyanophenyl)-10,10-dimethyl-14-oxo-7-(N-phenylanilino)-21-oxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),4(9),5,7,12,15,17,19-nonaen-16-yl]benzonitrile |
|---|---|
| PubChem CID | 164758672 |
| Molecular Formula | C48H31N3O2 |
| Molecular Weight | 681.80 g/mol |
| Exact Mass | 681.24 |
| IUPAC Name | 2-[18-(2-isocyanophenyl)-10,10-dimethyl-14-oxo-7-(N-phenylanilino)-21-oxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),4(9),5,7,12,15,17,19-nonaen-16-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccccc1-c1cc(-c2ccccc2C#N)c2c(=O)c3cc4c(cc3oc2c1)-c1ccc(N(c2ccccc2)c2ccccc2)cc1C4(C)C |
| InChI | InChI=1S/C48H31N3O2/c1-48(2)41-26-34(51(32-15-6-4-7-16-32)33-17-8-5-9-18-33)22-23-37(41)38-28-44-40(27-42(38)48)47(52)46-39(35-19-11-10-14-30(35)29-49)24-31(25-45(46)53-44)36-20-12-13-21-43(36)50-3/h4-28H,1-2H3 |
| InChIKey | GBSFJUXNMFOULF-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.80 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|