About CID 164758893
CID 164758893 (PubChem CID 164758893) has the molecular formula C48H38N4O4S4
and a molecular weight of 863.12 g/mol.
Molecular Properties
| Compound Name | CID 164758893 |
| PubChem CID | 164758893 |
| Molecular Formula | C48H38N4O4S4 |
| Molecular Weight | 863.12 g/mol |
| Exact Mass | 862.18 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]C(=Cc1cc(OC)c(-c2cc3c(s2)C2=CC4C=C5C(=CC4C=C2C2(CCCCC2)O3)c2sc(-c3sc(C=C(C#N)C#N)cc3OC)cc2OC52CCCCC2)s1)[N+]#[C-] |
| InChI | InChI=1S/C48H38N4O4S4/c1-51-42(52-2)22-31-21-37(54-4)46(58-31)41-24-39-44(60-41)33-17-29-18-34-32(16-28(29)19-35(33)48(56-39)13-9-6-10-14-48)43-38(55-47(34)11-7-5-8-12-47)23-40(59-43)45-36(53-3)20-30(57-45)15-27(25-49)26-50/h15-24,28-29H,5-14H2,3-4H3 |
| InChIKey | SRISTPWKGIJVPK-UHFFFAOYSA-N |
| XLogP | 13.62 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 863.12 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze CID 164758893 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164758893?
The IUPAC name of CID 164758893 (CID 164758893) is not available.
What is the SMILES notation for CID 164758893?
The canonical SMILES for CID 164758893 is [C-]#[N+]C(=Cc1cc(OC)c(-c2cc3c(s2)C2=CC4C=C5C(=CC4C=C2C2(CCCCC2)O3)c2sc(-c3sc(C=C(C#N)C#N)cc3OC)cc2OC52CCCCC2)s1)[N+]#[C-].
What is the InChIKey of CID 164758893?
The InChIKey is SRISTPWKGIJVPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C48H38N4O4S4/c1-51-42(52-2)22-31-21-37(54-4)46(58-31)41-24-39-44(60-41)33-17-29-18-34-32(16-28(29)19-35(33)48(56-39)13-9-6-10-14-48)43-38(55-47(34)11-7-5-8-12-47)23-40(59-43)45-36(53-3)20-30(57-45)15-27(25-49)26-50/h15-24,28-29H,5-14H2,3-4H3.
What are the key properties of CID 164758893?
CID 164758893 has a molecular weight of 863.12 g/mol, XLogP of 13.62, 6 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164758893 is sourced from PubChem (CID 164758893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).