About CID 164758931
CID 164758931 (PubChem CID 164758931) has the molecular formula C32H22N6O2S4
and a molecular weight of 650.84 g/mol.
Molecular Properties
| Compound Name | CID 164758931 |
| PubChem CID | 164758931 |
| Molecular Formula | C32H22N6O2S4 |
| Molecular Weight | 650.84 g/mol |
| Exact Mass | 650.07 |
| IUPAC Name | — |
| SMILES | N#CC(C#N)=Nc1cc2c(s1)-c1sc3c4c(sc3c1OC21CCCCC1)-c1sc(N=C(C#N)C#N)cc1C1(CCCCC1)O4 |
| InChI | InChI=1S/C32H22N6O2S4/c33-13-17(14-34)37-21-11-19-25(41-21)27-23(39-31(19)7-3-1-4-8-31)29-30(43-27)24-28(44-29)26-20(32(40-24)9-5-2-6-10-32)12-22(42-26)38-18(15-35)16-36/h11-12H,1-10H2 |
| InChIKey | JYCSARNMEHRXOA-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 138.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 650.84 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 164758931 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164758931?
The IUPAC name of CID 164758931 (CID 164758931) is not available.
What is the SMILES notation for CID 164758931?
The canonical SMILES for CID 164758931 is N#CC(C#N)=Nc1cc2c(s1)-c1sc3c4c(sc3c1OC21CCCCC1)-c1sc(N=C(C#N)C#N)cc1C1(CCCCC1)O4.
What is the InChIKey of CID 164758931?
The InChIKey is JYCSARNMEHRXOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H22N6O2S4/c33-13-17(14-34)37-21-11-19-25(41-21)27-23(39-31(19)7-3-1-4-8-31)29-30(43-27)24-28(44-29)26-20(32(40-24)9-5-2-6-10-32)12-22(42-26)38-18(15-35)16-36/h11-12H,1-10H2.
What are the key properties of CID 164758931?
CID 164758931 has a molecular weight of 650.84 g/mol, XLogP of 9.76, 2 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164758931 is sourced from PubChem (CID 164758931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).