About CID 164758932
CID 164758932 (PubChem CID 164758932) has the molecular formula C62H42O6S2
and a molecular weight of 947.15 g/mol.
Molecular Properties
| Compound Name | CID 164758932 |
| PubChem CID | 164758932 |
| Molecular Formula | C62H42O6S2 |
| Molecular Weight | 947.15 g/mol |
| Exact Mass | 946.24 |
| IUPAC Name | — |
| SMILES | O=C1C(=Cc2cc3c(s2)-c2cc4c(cc2OC32CCCCC2)-c2sc(C=C3C(=O)c5cc6cc7ccccc7cc6cc5C3=O)cc2C2(CCCCC2)O4)C(=O)c2cc3cc4ccccc4cc3cc21 |
| InChI | InChI=1S/C62H42O6S2/c63-55-43-23-37-19-33-11-3-4-12-34(33)20-38(37)24-44(43)56(64)49(55)27-41-29-51-59(69-41)47-32-54-48(31-53(47)67-61(51)15-7-1-8-16-61)60-52(62(68-54)17-9-2-10-18-62)30-42(70-60)28-50-57(65)45-25-39-21-35-13-5-6-14-36(35)22-40(39)26-46(45)58(50)66/h3-6,11-14,19-32H,1-2,7-10,15-18H2 |
| InChIKey | ZWLYWRKGLDAKFV-UHFFFAOYSA-N |
| XLogP | 15.79 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 70 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 947.15 |
| LogP ≤ 5 | 15.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze CID 164758932 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164758932?
The IUPAC name of CID 164758932 (CID 164758932) is not available.
What is the SMILES notation for CID 164758932?
The canonical SMILES for CID 164758932 is O=C1C(=Cc2cc3c(s2)-c2cc4c(cc2OC32CCCCC2)-c2sc(C=C3C(=O)c5cc6cc7ccccc7cc6cc5C3=O)cc2C2(CCCCC2)O4)C(=O)c2cc3cc4ccccc4cc3cc21.
What is the InChIKey of CID 164758932?
The InChIKey is ZWLYWRKGLDAKFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C62H42O6S2/c63-55-43-23-37-19-33-11-3-4-12-34(33)20-38(37)24-44(43)56(64)49(55)27-41-29-51-59(69-41)47-32-54-48(31-53(47)67-61(51)15-7-1-8-16-61)60-52(62(68-54)17-9-2-10-18-62)30-42(70-60)28-50-57(65)45-25-39-21-35-13-5-6-14-36(35)22-40(39)26-46(45)58(50)66/h3-6,11-14,19-32H,1-2,7-10,15-18H2.
What are the key properties of CID 164758932?
CID 164758932 has a molecular weight of 947.15 g/mol, XLogP of 15.79, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164758932 is sourced from PubChem (CID 164758932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).