About CID 164759019
CID 164759019 (PubChem CID 164759019) has the molecular formula C42H32N4O2S5
and a molecular weight of 785.08 g/mol.
Molecular Properties
| Compound Name | CID 164759019 |
| PubChem CID | 164759019 |
| Molecular Formula | C42H32N4O2S5 |
| Molecular Weight | 785.08 g/mol |
| Exact Mass | 784.11 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]/C(C#N)=C\c1cc(OC)c(-c2cc3sc4c(c3s2)C2(CCCCC2)C2=C4C3(CCCCC3)c3cc(-c4sc(/C=C(\C#N)[N+]#[C-])cc4OC)sc32)s1 |
| InChI | InChI=1S/C42H32N4O2S5/c1-45-23(21-43)15-25-17-28(47-3)37(49-25)30-19-27-36(51-30)33-34(41(27)11-7-5-8-12-41)40-35(42(33)13-9-6-10-14-42)39-32(53-40)20-31(52-39)38-29(48-4)18-26(50-38)16-24(22-44)46-2/h15-20H,5-14H2,3-4H3/b23-15+,24-16- |
| InChIKey | AYLBLFKBEOSNDY-LGBOEXNSSA-N |
| XLogP | 13.41 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 785.08 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze CID 164759019 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164759019?
The IUPAC name of CID 164759019 (CID 164759019) is not available.
What is the SMILES notation for CID 164759019?
The canonical SMILES for CID 164759019 is [C-]#[N+]/C(C#N)=C\c1cc(OC)c(-c2cc3sc4c(c3s2)C2(CCCCC2)C2=C4C3(CCCCC3)c3cc(-c4sc(/C=C(\C#N)[N+]#[C-])cc4OC)sc32)s1.
What is the InChIKey of CID 164759019?
The InChIKey is AYLBLFKBEOSNDY-LGBOEXNSSA-N. The full InChI is InChI=1S/C42H32N4O2S5/c1-45-23(21-43)15-25-17-28(47-3)37(49-25)30-19-27-36(51-30)33-34(41(27)11-7-5-8-12-41)40-35(42(33)13-9-6-10-14-42)39-32(53-40)20-31(52-39)38-29(48-4)18-26(50-38)16-24(22-44)46-2/h15-20H,5-14H2,3-4H3/b23-15+,24-16-.
What are the key properties of CID 164759019?
CID 164759019 has a molecular weight of 785.08 g/mol, XLogP of 13.41, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164759019 is sourced from PubChem (CID 164759019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).