About CID 164759069
CID 164759069 (PubChem CID 164759069) has the molecular formula C46H34N4O2S4
and a molecular weight of 803.07 g/mol.
Molecular Properties
| Compound Name | CID 164759069 |
| PubChem CID | 164759069 |
| Molecular Formula | C46H34N4O2S4 |
| Molecular Weight | 803.07 g/mol |
| Exact Mass | 802.16 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]/C(C#N)=C\c1ccc(-c2cc3c(s2)C2=CC4C=C5OC6(CCCCC6)c6cc(-c7ccc(/C=C(\C#N)[N+]#[C-])s7)sc6C5=CC4C=C2OC32CCCCC2)s1 |
| InChI | InChI=1S/C46H34N4O2S4/c1-49-29(25-47)21-31-9-11-39(53-31)41-23-35-43(55-41)33-17-27-20-38-34(18-28(27)19-37(33)51-45(35)13-5-3-6-14-45)44-36(46(52-38)15-7-4-8-16-46)24-42(56-44)40-12-10-32(54-40)22-30(26-48)50-2/h9-12,17-24,27-28H,3-8,13-16H2/b29-21-,30-22+ |
| InChIKey | PFZUODARFBDZNA-DWVPNOFWSA-N |
| XLogP | 13.71 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 803.07 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze CID 164759069 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164759069?
The IUPAC name of CID 164759069 (CID 164759069) is not available.
What is the SMILES notation for CID 164759069?
The canonical SMILES for CID 164759069 is [C-]#[N+]/C(C#N)=C\c1ccc(-c2cc3c(s2)C2=CC4C=C5OC6(CCCCC6)c6cc(-c7ccc(/C=C(\C#N)[N+]#[C-])s7)sc6C5=CC4C=C2OC32CCCCC2)s1.
What is the InChIKey of CID 164759069?
The InChIKey is PFZUODARFBDZNA-DWVPNOFWSA-N. The full InChI is InChI=1S/C46H34N4O2S4/c1-49-29(25-47)21-31-9-11-39(53-31)41-23-35-43(55-41)33-17-27-20-38-34(18-28(27)19-37(33)51-45(35)13-5-3-6-14-45)44-36(46(52-38)15-7-4-8-16-46)24-42(56-44)40-12-10-32(54-40)22-30(26-48)50-2/h9-12,17-24,27-28H,3-8,13-16H2/b29-21-,30-22+.
What are the key properties of CID 164759069?
CID 164759069 has a molecular weight of 803.07 g/mol, XLogP of 13.71, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164759069 is sourced from PubChem (CID 164759069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).