About CID 164759092
CID 164759092 (PubChem CID 164759092) has the molecular formula C44H32N4O4S6
and a molecular weight of 873.17 g/mol.
Molecular Properties
| Compound Name | CID 164759092 |
| PubChem CID | 164759092 |
| Molecular Formula | C44H32N4O4S6 |
| Molecular Weight | 873.17 g/mol |
| Exact Mass | 872.07 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]/C(C#N)=C/c1cc(OC)c(-c2cc3c(s2)-c2sc4c5c(sc4c2C2(CCCCC2)O3)-c2sc(-c3sc(C=C(C#N)C#N)cc3OC)cc2OC52CCCCC2)s1 |
| InChI | InChI=1S/C44H32N4O4S6/c1-48-24(22-47)15-26-17-28(50-3)36(54-26)32-19-30-38(56-32)40-34(44(52-30)12-8-5-9-13-44)42-41(58-40)33-39(57-42)37-29(51-43(33)10-6-4-7-11-43)18-31(55-37)35-27(49-2)16-25(53-35)14-23(20-45)21-46/h14-19H,4-13H2,2-3H3/b24-15+ |
| InChIKey | CGSNEQNDLRHQTA-BUVRLJJBSA-N |
| XLogP | 14.21 |
| TPSA | 112.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 873.17 |
| LogP ≤ 5 | 14.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze CID 164759092 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164759092?
The IUPAC name of CID 164759092 (CID 164759092) is not available.
What is the SMILES notation for CID 164759092?
The canonical SMILES for CID 164759092 is [C-]#[N+]/C(C#N)=C/c1cc(OC)c(-c2cc3c(s2)-c2sc4c5c(sc4c2C2(CCCCC2)O3)-c2sc(-c3sc(C=C(C#N)C#N)cc3OC)cc2OC52CCCCC2)s1.
What is the InChIKey of CID 164759092?
The InChIKey is CGSNEQNDLRHQTA-BUVRLJJBSA-N. The full InChI is InChI=1S/C44H32N4O4S6/c1-48-24(22-47)15-26-17-28(50-3)36(54-26)32-19-30-38(56-32)40-34(44(52-30)12-8-5-9-13-44)42-41(58-40)33-39(57-42)37-29(51-43(33)10-6-4-7-11-43)18-31(55-37)35-27(49-2)16-25(53-35)14-23(20-45)21-46/h14-19H,4-13H2,2-3H3/b24-15+.
What are the key properties of CID 164759092?
CID 164759092 has a molecular weight of 873.17 g/mol, XLogP of 14.21, 6 rotatable bonds, 0 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164759092 is sourced from PubChem (CID 164759092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).