About CID 164759152
CID 164759152 (PubChem CID 164759152) has the molecular formula C54H34F4O6S2
and a molecular weight of 918.99 g/mol.
Molecular Properties
| Compound Name | CID 164759152 |
| PubChem CID | 164759152 |
| Molecular Formula | C54H34F4O6S2 |
| Molecular Weight | 918.99 g/mol |
| Exact Mass | 918.17 |
| IUPAC Name | — |
| SMILES | O=C1C(=Cc2cc3c(s2)-c2cc4c(cc2C2(CCCCC2)O3)-c2sc(C=C3C(=O)c5cc6cc(F)c(F)cc6cc5C3=O)cc2OC42CCCCC2)C(=O)c2cc3cc(F)c(F)cc3cc21 |
| InChI | InChI=1S/C54H34F4O6S2/c55-41-15-25-11-31-32(12-26(25)16-42(41)56)48(60)37(47(31)59)19-29-21-45-51(65-29)35-24-40-36(23-39(35)53(63-45)7-3-1-4-8-53)52-46(64-54(40)9-5-2-6-10-54)22-30(66-52)20-38-49(61)33-13-27-17-43(57)44(58)18-28(27)14-34(33)50(38)62/h11-24H,1-10H2 |
| InChIKey | VUHHRRWOAOUXAG-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 918.99 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze CID 164759152 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164759152?
The IUPAC name of CID 164759152 (CID 164759152) is not available.
What is the SMILES notation for CID 164759152?
The canonical SMILES for CID 164759152 is O=C1C(=Cc2cc3c(s2)-c2cc4c(cc2C2(CCCCC2)O3)-c2sc(C=C3C(=O)c5cc6cc(F)c(F)cc6cc5C3=O)cc2OC42CCCCC2)C(=O)c2cc3cc(F)c(F)cc3cc21.
What is the InChIKey of CID 164759152?
The InChIKey is VUHHRRWOAOUXAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C54H34F4O6S2/c55-41-15-25-11-31-32(12-26(25)16-42(41)56)48(60)37(47(31)59)19-29-21-45-51(65-29)35-24-40-36(23-39(35)53(63-45)7-3-1-4-8-53)52-46(64-54(40)9-5-2-6-10-54)22-30(66-52)20-38-49(61)33-13-27-17-43(57)44(58)18-28(27)14-34(33)50(38)62/h11-24H,1-10H2.
What are the key properties of CID 164759152?
CID 164759152 has a molecular weight of 918.99 g/mol, XLogP of 14.04, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164759152 is sourced from PubChem (CID 164759152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).