C35H25N7OS4 — CID 164759547
3-ethyl-5-[[5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-[2,1,3]benzothiadiazolo[7,6-g][2,1,3]benzothiadiazol-10-yl]imino]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 164759547) has the molecular formula C35H25N7OS4 and a molecular weight of 687.90 g/mol. Its IUPAC name is 3-ethyl-5-[[5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-[2,1,3]benzothiadiazolo[7,6-g][2,1,3]benzothiadiazol-10-yl]imino]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-ethyl-5-[[5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-[2,1,3]benzothiadiazolo[7,6-g][2,1,3]benzothiadiazol-10-yl]imino]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 164759547 |
| Molecular Formula | C35H25N7OS4 |
| Molecular Weight | 687.90 g/mol |
| Exact Mass | 687.10 |
| IUPAC Name | 3-ethyl-5-[[5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-[2,1,3]benzothiadiazolo[7,6-g][2,1,3]benzothiadiazol-10-yl]imino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=N\c2cc3c(cc(-c4ccc(N(c5ccc(C)cc5)c5ccc(C)cc5)cc4)c4nsnc43)c3nsnc23)SC1=S |
| InChI | InChI=1S/C35H25N7OS4/c1-4-41-34(43)33(45-35(41)44)36-28-18-27-26(31-32(28)40-47-39-31)17-25(29-30(27)38-46-37-29)21-9-15-24(16-10-21)42(22-11-5-19(2)6-12-22)23-13-7-20(3)8-14-23/h5-18H,4H2,1-3H3/b36-33+ |
| InChIKey | SYOIJWBJSYNMBY-PKUSAGTQSA-N |
| XLogP | 9.51 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.90 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|