About 6-fluoro-1,2-dimethylfuro[2,3-d]imidazole
6-fluoro-1,2-dimethylfuro[2,3-d]imidazole (PubChem CID 164760672) has the molecular formula C7H7FN2O
and a molecular weight of 154.14 g/mol. Its IUPAC name is 6-fluoro-1,2-dimethylfuro[2,3-d]imidazole.
Molecular Properties
| Compound Name | 6-fluoro-1,2-dimethylfuro[2,3-d]imidazole |
| PubChem CID | 164760672 |
| Molecular Formula | C7H7FN2O |
| Molecular Weight | 154.14 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 6-fluoro-1,2-dimethylfuro[2,3-d]imidazole |
| SMILES | Cc1nc2occ(F)c2n1C |
| InChI | InChI=1S/C7H7FN2O/c1-4-9-7-6(10(4)2)5(8)3-11-7/h3H,1-2H3 |
| InChIKey | AONPHFHJNXDNBM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.14 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-1,2-dimethylfuro[2,3-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1,2-dimethylfuro[2,3-d]imidazole?
The IUPAC name of 6-fluoro-1,2-dimethylfuro[2,3-d]imidazole (CID 164760672) is 6-fluoro-1,2-dimethylfuro[2,3-d]imidazole.
What is the SMILES notation for 6-fluoro-1,2-dimethylfuro[2,3-d]imidazole?
The canonical SMILES for 6-fluoro-1,2-dimethylfuro[2,3-d]imidazole is Cc1nc2occ(F)c2n1C.
What is the InChIKey of 6-fluoro-1,2-dimethylfuro[2,3-d]imidazole?
The InChIKey is AONPHFHJNXDNBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FN2O/c1-4-9-7-6(10(4)2)5(8)3-11-7/h3H,1-2H3.
What are the key properties of 6-fluoro-1,2-dimethylfuro[2,3-d]imidazole?
6-fluoro-1,2-dimethylfuro[2,3-d]imidazole has a molecular weight of 154.14 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1,2-dimethylfuro[2,3-d]imidazole is sourced from PubChem (CID 164760672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).