C23H21N3O2S2 — CID 164761085
2-methyl-4-[6-[2-(2-methyl-1-benzothiophen-3-yl)ethylamino]pyrimidin-4-yl]-3-sulfanylbenzoic acid (PubChem CID 164761085) has the molecular formula C23H21N3O2S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-methyl-4-[6-[2-(2-methyl-1-benzothiophen-3-yl)ethylamino]pyrimidin-4-yl]-3-sulfanylbenzoic acid.
| Compound Name | 2-methyl-4-[6-[2-(2-methyl-1-benzothiophen-3-yl)ethylamino]pyrimidin-4-yl]-3-sulfanylbenzoic acid |
|---|---|
| PubChem CID | 164761085 |
| Molecular Formula | C23H21N3O2S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 2-methyl-4-[6-[2-(2-methyl-1-benzothiophen-3-yl)ethylamino]pyrimidin-4-yl]-3-sulfanylbenzoic acid |
| SMILES | Cc1sc2ccccc2c1CCNc1cc(-c2ccc(C(=O)O)c(C)c2S)ncn1 |
| InChI | InChI=1S/C23H21N3O2S2/c1-13-15(23(27)28)7-8-18(22(13)29)19-11-21(26-12-25-19)24-10-9-16-14(2)30-20-6-4-3-5-17(16)20/h3-8,11-12,29H,9-10H2,1-2H3,(H,27,28)(H,24,25,26) |
| InChIKey | QWZXIDXOFRYTEN-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|