C14H23N3OS — CID 164761812
3-(3,3,4,4,5,5-hexadeuteriohexoxy)-4-[1-(trideuteriomethyl)-3,6-dihydro-2H-pyridin-5-yl]-1,2,5-thiadiazole (PubChem CID 164761812) has the molecular formula C14H23N3OS and a molecular weight of 290.48 g/mol. Its IUPAC name is 3-(3,3,4,4,5,5-hexadeuteriohexoxy)-4-[1-(trideuteriomethyl)-3,6-dihydro-2H-pyridin-5-yl]-1,2,5-thiadiazole.
| Compound Name | 3-(3,3,4,4,5,5-hexadeuteriohexoxy)-4-[1-(trideuteriomethyl)-3,6-dihydro-2H-pyridin-5-yl]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 164761812 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 3-(3,3,4,4,5,5-hexadeuteriohexoxy)-4-[1-(trideuteriomethyl)-3,6-dihydro-2H-pyridin-5-yl]-1,2,5-thiadiazole |
| SMILES | [2H]C([2H])([2H])N1CCC=C(c2nsnc2OCCC([2H])([2H])C([2H])([2H])C([2H])([2H])C)C1 |
| InChI | InChI=1S/C14H23N3OS/c1-3-4-5-6-10-18-14-13(15-19-16-14)12-8-7-9-17(2)11-12/h8H,3-7,9-11H2,1-2H3/i2D3,3D2,4D2,5D2 |
| InChIKey | JOLJIIDDOBNFHW-GTRAZEJVSA-N |
| XLogP | 3.22 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |