C16H27N — CID 164761855
2,3-ditert-butyl-4,5,6,7-tetrahydro-3aH-indole (PubChem CID 164761855) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 2,3-ditert-butyl-4,5,6,7-tetrahydro-3aH-indole.
| Compound Name | 2,3-ditert-butyl-4,5,6,7-tetrahydro-3aH-indole |
|---|---|
| PubChem CID | 164761855 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 2,3-ditert-butyl-4,5,6,7-tetrahydro-3aH-indole |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)C2CCCCC2=N1 |
| InChI | InChI=1S/C16H27N/c1-15(2,3)13-11-9-7-8-10-12(11)17-14(13)16(4,5)6/h11H,7-10H2,1-6H3 |
| InChIKey | SKYIDVHFHZGEKF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |