C20H18FN3O2 — CID 164762281
12,12-dideuterio-2-[3-fluoro-4-[(2R)-pyrrolidin-2-yl]phenyl]-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one (PubChem CID 164762281) has the molecular formula C20H18FN3O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is 12,12-dideuterio-2-[3-fluoro-4-[(2R)-pyrrolidin-2-yl]phenyl]-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one.
| Compound Name | 12,12-dideuterio-2-[3-fluoro-4-[(2R)-pyrrolidin-2-yl]phenyl]-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 164762281 |
| Molecular Formula | C20H18FN3O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 12,12-dideuterio-2-[3-fluoro-4-[(2R)-pyrrolidin-2-yl]phenyl]-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
| SMILES | [2H]C1([2H])ONC(=O)c2cccc3[nH]c(-c4ccc([C@H]5CCCN5)c(F)c4)c1c23 |
| InChI | InChI=1S/C20H18FN3O2/c21-15-9-11(6-7-12(15)16-5-2-8-22-16)19-14-10-26-24-20(25)13-3-1-4-17(23-19)18(13)14/h1,3-4,6-7,9,16,22-23H,2,5,8,10H2,(H,24,25)/t16-/m1/s1/i10D2 |
| InChIKey | QYXUYLFPBVAQPJ-SXDNYQJHSA-N |
| XLogP | 3.57 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |