C35H29N5O — CID 164762393
7-[2-[[(1-benzylindol-6-yl)methylamino]methyl]-1H-indol-3-yl]-6,7-dihydro-1H-pyrrolo[3,4-f]indol-5-one (PubChem CID 164762393) has the molecular formula C35H29N5O and a molecular weight of 535.65 g/mol. Its IUPAC name is 7-[2-[[(1-benzylindol-6-yl)methylamino]methyl]-1H-indol-3-yl]-6,7-dihydro-1H-pyrrolo[3,4-f]indol-5-one.
| Compound Name | 7-[2-[[(1-benzylindol-6-yl)methylamino]methyl]-1H-indol-3-yl]-6,7-dihydro-1H-pyrrolo[3,4-f]indol-5-one |
|---|---|
| PubChem CID | 164762393 |
| Molecular Formula | C35H29N5O |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 7-[2-[[(1-benzylindol-6-yl)methylamino]methyl]-1H-indol-3-yl]-6,7-dihydro-1H-pyrrolo[3,4-f]indol-5-one |
| SMILES | O=C1NC(c2c(CNCc3ccc4ccn(Cc5ccccc5)c4c3)[nH]c3ccccc23)c2cc3[nH]ccc3cc21 |
| InChI | InChI=1S/C35H29N5O/c41-35-28-17-25-12-14-37-30(25)18-27(28)34(39-35)33-26-8-4-5-9-29(26)38-31(33)20-36-19-23-10-11-24-13-15-40(32(24)16-23)21-22-6-2-1-3-7-22/h1-18,34,36-38H,19-21H2,(H,39,41) |
| InChIKey | POQPLOWMUAFFNP-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 77.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|