C16H30N2O — CID 164762663
2,8-ditert-butyl-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 164762663) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 2,8-ditert-butyl-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 2,8-ditert-butyl-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 164762663 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 2,8-ditert-butyl-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | CC(C)(C)N1CCC2(CC1)CC(=O)N(C(C)(C)C)C2 |
| InChI | InChI=1S/C16H30N2O/c1-14(2,3)17-9-7-16(8-10-17)11-13(19)18(12-16)15(4,5)6/h7-12H2,1-6H3 |
| InChIKey | NVMXVHOIDYMARC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |