C16H23F3 — CID 164762951
1,4-bis(2,2-dimethylpropyl)-2,3,5-trifluorobenzene (PubChem CID 164762951) has the molecular formula C16H23F3 and a molecular weight of 272.35 g/mol. Its IUPAC name is 1,4-bis(2,2-dimethylpropyl)-2,3,5-trifluorobenzene.
| Compound Name | 1,4-bis(2,2-dimethylpropyl)-2,3,5-trifluorobenzene |
|---|---|
| PubChem CID | 164762951 |
| Molecular Formula | C16H23F3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1,4-bis(2,2-dimethylpropyl)-2,3,5-trifluorobenzene |
| SMILES | CC(C)(C)Cc1cc(F)c(CC(C)(C)C)c(F)c1F |
| InChI | InChI=1S/C16H23F3/c1-15(2,3)8-10-7-12(17)11(9-16(4,5)6)14(19)13(10)18/h7H,8-9H2,1-6H3 |
| InChIKey | HEGBBJPFFFNWFJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|