C20H26N4 — CID 164763104
2-[2-cyano-5,5-dimethyl-3-(3,4,5-trimethylpiperidin-1-yl)cyclohex-2-en-1-ylidene]propanedinitrile (PubChem CID 164763104) has the molecular formula C20H26N4 and a molecular weight of 322.46 g/mol. Its IUPAC name is 2-[2-cyano-5,5-dimethyl-3-(3,4,5-trimethylpiperidin-1-yl)cyclohex-2-en-1-ylidene]propanedinitrile.
| Compound Name | 2-[2-cyano-5,5-dimethyl-3-(3,4,5-trimethylpiperidin-1-yl)cyclohex-2-en-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 164763104 |
| Molecular Formula | C20H26N4 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 2-[2-cyano-5,5-dimethyl-3-(3,4,5-trimethylpiperidin-1-yl)cyclohex-2-en-1-ylidene]propanedinitrile |
| SMILES | CC1CN(C2=C(C#N)C(=C(C#N)C#N)CC(C)(C)C2)CC(C)C1C |
| InChI | InChI=1S/C20H26N4/c1-13-11-24(12-14(2)15(13)3)19-7-20(4,5)6-17(18(19)10-23)16(8-21)9-22/h13-15H,6-7,11-12H2,1-5H3 |
| InChIKey | DVDXKYJHRSVDLW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 74.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|