C17H18F5N3 — CID 164763230
2-[5,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene]propanedinitrile (PubChem CID 164763230) has the molecular formula C17H18F5N3 and a molecular weight of 359.34 g/mol. Its IUPAC name is 2-[5,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene]propanedinitrile.
| Compound Name | 2-[5,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 164763230 |
| Molecular Formula | C17H18F5N3 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-[5,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene]propanedinitrile |
| SMILES | CC1(C)CC(=C(C#N)C#N)C(C(F)(F)C(F)(F)F)=C(N2CCCC2)C1 |
| InChI | InChI=1S/C17H18F5N3/c1-15(2)7-12(11(9-23)10-24)14(16(18,19)17(20,21)22)13(8-15)25-5-3-4-6-25/h3-8H2,1-2H3 |
| InChIKey | XJGTZPKAFKBGET-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|