C12H13F3N2 — CID 164763830
N,N-dimethyl-2-(2,6,7-trifluoro-1H-indol-3-yl)ethanamine (PubChem CID 164763830) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is N,N-dimethyl-2-(2,6,7-trifluoro-1H-indol-3-yl)ethanamine.
| Compound Name | N,N-dimethyl-2-(2,6,7-trifluoro-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 164763830 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | N,N-dimethyl-2-(2,6,7-trifluoro-1H-indol-3-yl)ethanamine |
| SMILES | CN(C)CCc1c(F)[nH]c2c(F)c(F)ccc12 |
| InChI | InChI=1S/C12H13F3N2/c1-17(2)6-5-8-7-3-4-9(13)10(14)11(7)16-12(8)15/h3-4,16H,5-6H2,1-2H3 |
| InChIKey | PKKGHHMSHMKIOD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |