C25H25N9O3 — CID 164764116
ethyl 2-[2-[4-(5-hydroxy-2-pyridinyl)piperazin-1-yl]-6-indazol-1-ylpurin-7-yl]acetate (PubChem CID 164764116) has the molecular formula C25H25N9O3 and a molecular weight of 499.54 g/mol. Its IUPAC name is ethyl 2-[2-[4-(5-hydroxy-2-pyridinyl)piperazin-1-yl]-6-indazol-1-ylpurin-7-yl]acetate.
| Compound Name | ethyl 2-[2-[4-(5-hydroxy-2-pyridinyl)piperazin-1-yl]-6-indazol-1-ylpurin-7-yl]acetate |
|---|---|
| PubChem CID | 164764116 |
| Molecular Formula | C25H25N9O3 |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | ethyl 2-[2-[4-(5-hydroxy-2-pyridinyl)piperazin-1-yl]-6-indazol-1-ylpurin-7-yl]acetate |
| SMILES | CCOC(=O)Cn1cnc2nc(N3CCN(c4ccc(O)cn4)CC3)nc(-n3ncc4ccccc43)c21 |
| InChI | InChI=1S/C25H25N9O3/c1-2-37-21(36)15-33-16-27-23-22(33)24(34-19-6-4-3-5-17(19)13-28-34)30-25(29-23)32-11-9-31(10-12-32)20-8-7-18(35)14-26-20/h3-8,13-14,16,35H,2,9-12,15H2,1H3 |
| InChIKey | SFCASZXKRAXZCD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 127.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |