C12H15F3N2O5 — CID 164764333
N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 164764333) has the molecular formula C12H15F3N2O5 and a molecular weight of 324.25 g/mol. Its IUPAC name is N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 164764333 |
| Molecular Formula | C12H15F3N2O5 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C1C=CC(=O)N1CCOCCOCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O5/c13-12(14,15)11(20)16-3-5-21-7-8-22-6-4-17-9(18)1-2-10(17)19/h1-2H,3-8H2,(H,16,20) |
| InChIKey | IQQJEGNOMIURSY-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|