C36H24N4S — CID 164764904
1,2-diphenyl-8-(4-phenylquinazolin-2-yl)-5H-imidazo[1,2-a][3,1]benzothiazine (PubChem CID 164764904) has the molecular formula C36H24N4S and a molecular weight of 544.68 g/mol. Its IUPAC name is 1,2-diphenyl-8-(4-phenylquinazolin-2-yl)-5H-imidazo[1,2-a][3,1]benzothiazine.
| Compound Name | 1,2-diphenyl-8-(4-phenylquinazolin-2-yl)-5H-imidazo[1,2-a][3,1]benzothiazine |
|---|---|
| PubChem CID | 164764904 |
| Molecular Formula | C36H24N4S |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | 1,2-diphenyl-8-(4-phenylquinazolin-2-yl)-5H-imidazo[1,2-a][3,1]benzothiazine |
| SMILES | c1ccc(-c2nc3n(c2-c2ccccc2)-c2cc(-c4nc(-c5ccccc5)c5ccccc5n4)ccc2CS3)cc1 |
| InChI | InChI=1S/C36H24N4S/c1-4-12-24(13-5-1)32-29-18-10-11-19-30(29)37-35(38-32)27-20-21-28-23-41-36-39-33(25-14-6-2-7-15-25)34(40(36)31(28)22-27)26-16-8-3-9-17-26/h1-22H,23H2 |
| InChIKey | XTEXOLXWOTXLLZ-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |