C20H16Cl2F3N5O5 — CID 164765758
ethyl N-[2-cyano-2-[[3,5-dichloro-4-[[6-oxo-1-(1,1,1-trifluoropropan-2-yl)-3-pyridinyl]oxy]phenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 164765758) has the molecular formula C20H16Cl2F3N5O5 and a molecular weight of 534.28 g/mol. Its IUPAC name is ethyl N-[2-cyano-2-[[3,5-dichloro-4-[[6-oxo-1-(1,1,1-trifluoropropan-2-yl)-3-pyridinyl]oxy]phenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[2-cyano-2-[[3,5-dichloro-4-[[6-oxo-1-(1,1,1-trifluoropropan-2-yl)-3-pyridinyl]oxy]phenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 164765758 |
| Molecular Formula | C20H16Cl2F3N5O5 |
| Molecular Weight | 534.28 g/mol |
| Exact Mass | 533.05 |
| IUPAC Name | ethyl N-[2-cyano-2-[[3,5-dichloro-4-[[6-oxo-1-(1,1,1-trifluoropropan-2-yl)-3-pyridinyl]oxy]phenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=NNc1cc(Cl)c(Oc2ccc(=O)n(C(C)C(F)(F)F)c2)c(Cl)c1 |
| InChI | InChI=1S/C20H16Cl2F3N5O5/c1-3-34-19(33)27-18(32)15(8-26)29-28-11-6-13(21)17(14(22)7-11)35-12-4-5-16(31)30(9-12)10(2)20(23,24)25/h4-7,9-10,28H,3H2,1-2H3,(H,27,32,33) |
| InChIKey | FPUZWWQLVJQKPZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 134.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|