C32H34F7N3O5 — CID 164768912
methyl 5-[(2S)-4-[(3R,6S)-6-[6,8-bis(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine-3-carbonyl]-6-cyclopropyloxan-3-yl]-2-methylpiperazin-1-yl]-2-fluorobenzoate (PubChem CID 164768912) has the molecular formula C32H34F7N3O5 and a molecular weight of 673.63 g/mol. Its IUPAC name is methyl 5-[(2S)-4-[(3R,6S)-6-[6,8-bis(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine-3-carbonyl]-6-cyclopropyloxan-3-yl]-2-methylpiperazin-1-yl]-2-fluorobenzoate.
| Compound Name | methyl 5-[(2S)-4-[(3R,6S)-6-[6,8-bis(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine-3-carbonyl]-6-cyclopropyloxan-3-yl]-2-methylpiperazin-1-yl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 164768912 |
| Molecular Formula | C32H34F7N3O5 |
| Molecular Weight | 673.63 g/mol |
| Exact Mass | 673.24 |
| IUPAC Name | methyl 5-[(2S)-4-[(3R,6S)-6-[6,8-bis(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine-3-carbonyl]-6-cyclopropyloxan-3-yl]-2-methylpiperazin-1-yl]-2-fluorobenzoate |
| SMILES | COC(=O)c1cc(N2CCN([C@@H]3CC[C@@](C(=O)N4COc5c(cc(C(F)(F)F)cc5C(F)(F)F)C4)(C4CC4)OC3)C[C@@H]2C)ccc1F |
| InChI | InChI=1S/C32H34F7N3O5/c1-18-14-40(9-10-42(18)22-5-6-26(33)24(13-22)28(43)45-2)23-7-8-30(47-16-23,20-3-4-20)29(44)41-15-19-11-21(31(34,35)36)12-25(32(37,38)39)27(19)46-17-41/h5-6,11-13,18,20,23H,3-4,7-10,14-17H2,1-2H3/t18-,23+,30-/m0/s1 |
| InChIKey | IIYVCJDVBRUCDA-WBBHVKTFSA-N |
| XLogP | 5.87 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.63 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |