C13H17BrO — CID 164769527
1-bromo-3,3-dimethyl-5-phenylpentan-2-one (PubChem CID 164769527) has the molecular formula C13H17BrO and a molecular weight of 269.18 g/mol. Its IUPAC name is 1-bromo-3,3-dimethyl-5-phenylpentan-2-one.
| Compound Name | 1-bromo-3,3-dimethyl-5-phenylpentan-2-one |
|---|---|
| PubChem CID | 164769527 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1-bromo-3,3-dimethyl-5-phenylpentan-2-one |
| SMILES | CC(C)(CCc1ccccc1)C(=O)CBr |
| InChI | InChI=1S/C13H17BrO/c1-13(2,12(15)10-14)9-8-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3 |
| InChIKey | LTRRUGKGMTZKLX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|