C43H47BN2 — CID 164770074
17,20-ditert-butyl-3,8,25-trimethyl-21-phenyl-2,22-diaza-14-boraoctacyclo[12.12.1.12,9.115,19.03,8.023,27.013,29.022,28]nonacosa-1(26),9,11,13(29),15,17,19(28),20,23(27),24-decaene (PubChem CID 164770074) has the molecular formula C43H47BN2 and a molecular weight of 602.68 g/mol. Its IUPAC name is 17,20-ditert-butyl-3,8,25-trimethyl-21-phenyl-2,22-diaza-14-boraoctacyclo[12.12.1.12,9.115,19.03,8.023,27.013,29.022,28]nonacosa-1(26),9,11,13(29),15,17,19(28),20,23(27),24-decaene.
| Compound Name | 17,20-ditert-butyl-3,8,25-trimethyl-21-phenyl-2,22-diaza-14-boraoctacyclo[12.12.1.12,9.115,19.03,8.023,27.013,29.022,28]nonacosa-1(26),9,11,13(29),15,17,19(28),20,23(27),24-decaene |
|---|---|
| PubChem CID | 164770074 |
| Molecular Formula | C43H47BN2 |
| Molecular Weight | 602.68 g/mol |
| Exact Mass | 602.38 |
| IUPAC Name | 17,20-ditert-butyl-3,8,25-trimethyl-21-phenyl-2,22-diaza-14-boraoctacyclo[12.12.1.12,9.115,19.03,8.023,27.013,29.022,28]nonacosa-1(26),9,11,13(29),15,17,19(28),20,23(27),24-decaene |
| SMILES | Cc1cc2c3c(c1)-n1c(-c4ccccc4)c(C(C)(C)C)c4cc(C(C)(C)C)cc(c41)B3c1cccc3c1N2C1(C)CCCCC31C |
| InChI | InChI=1S/C43H47BN2/c1-26-22-33-36-34(23-26)46-39-30(42(8)20-13-14-21-43(42,46)9)18-15-19-31(39)44(36)32-25-28(40(2,3)4)24-29-35(41(5,6)7)37(45(33)38(29)32)27-16-11-10-12-17-27/h10-12,15-19,22-25H,13-14,20-21H2,1-9H3 |
| InChIKey | IKKNCYRXSBWEOK-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.68 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|