C54H46BN3 — CID 164770141
N,N-bis(4-tert-butylphenyl)-8,16-diphenyl-9,15-diaza-1-boraheptacyclo[12.8.1.12,6.115,18.010,23.09,25.022,24]pentacosa-2(25),3,5,7,10,12,14(23),16,18,20,22(24)-undecaen-12-amine (PubChem CID 164770141) has the molecular formula C54H46BN3 and a molecular weight of 747.80 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-8,16-diphenyl-9,15-diaza-1-boraheptacyclo[12.8.1.12,6.115,18.010,23.09,25.022,24]pentacosa-2(25),3,5,7,10,12,14(23),16,18,20,22(24)-undecaen-12-amine.
| Compound Name | N,N-bis(4-tert-butylphenyl)-8,16-diphenyl-9,15-diaza-1-boraheptacyclo[12.8.1.12,6.115,18.010,23.09,25.022,24]pentacosa-2(25),3,5,7,10,12,14(23),16,18,20,22(24)-undecaen-12-amine |
|---|---|
| PubChem CID | 164770141 |
| Molecular Formula | C54H46BN3 |
| Molecular Weight | 747.80 g/mol |
| Exact Mass | 747.38 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-8,16-diphenyl-9,15-diaza-1-boraheptacyclo[12.8.1.12,6.115,18.010,23.09,25.022,24]pentacosa-2(25),3,5,7,10,12,14(23),16,18,20,22(24)-undecaen-12-amine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2cc3c4c(c2)-n2c(-c5ccccc5)cc5cccc(c52)B4c2cccc4cc(-c5ccccc5)n-3c24)cc1 |
| InChI | InChI=1S/C54H46BN3/c1-53(2,3)39-23-27-41(28-24-39)56(42-29-25-40(26-30-42)54(4,5)6)43-33-48-50-49(34-43)58-47(36-17-11-8-12-18-36)32-38-20-14-22-45(52(38)58)55(50)44-21-13-19-37-31-46(57(48)51(37)44)35-15-9-7-10-16-35/h7-34H,1-6H3 |
| InChIKey | OWWYIABSFGQKFP-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.80 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|