C24H20ClN — CID 164770152
5-(3-chloro-5-methylphenyl)-6,6-dimethylindeno[2,1-b]indole (PubChem CID 164770152) has the molecular formula C24H20ClN and a molecular weight of 357.88 g/mol. Its IUPAC name is 5-(3-chloro-5-methylphenyl)-6,6-dimethylindeno[2,1-b]indole.
| Compound Name | 5-(3-chloro-5-methylphenyl)-6,6-dimethylindeno[2,1-b]indole |
|---|---|
| PubChem CID | 164770152 |
| Molecular Formula | C24H20ClN |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 5-(3-chloro-5-methylphenyl)-6,6-dimethylindeno[2,1-b]indole |
| SMILES | Cc1cc(Cl)cc(-n2c3c(c4ccccc42)-c2ccccc2C3(C)C)c1 |
| InChI | InChI=1S/C24H20ClN/c1-15-12-16(25)14-17(13-15)26-21-11-7-5-9-19(21)22-18-8-4-6-10-20(18)24(2,3)23(22)26/h4-14H,1-3H3 |
| InChIKey | MBAYEPOWKHTFMN-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |