C11H16N4O2Se — CID 164771378
2,2-dimethyl-4-nitro-N-propyl-2λ4,1,3-benzoselenadiazol-7-amine (PubChem CID 164771378) has the molecular formula C11H16N4O2Se and a molecular weight of 315.24 g/mol. Its IUPAC name is 2,2-dimethyl-4-nitro-N-propyl-2λ4,1,3-benzoselenadiazol-7-amine.
| Compound Name | 2,2-dimethyl-4-nitro-N-propyl-2λ4,1,3-benzoselenadiazol-7-amine |
|---|---|
| PubChem CID | 164771378 |
| Molecular Formula | C11H16N4O2Se |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 2,2-dimethyl-4-nitro-N-propyl-2λ4,1,3-benzoselenadiazol-7-amine |
| SMILES | CCCNc1ccc([N+](=O)[O-])c2c1=N[Se](C)(C)N=2 |
| InChI | InChI=1S/C11H16N4O2Se/c1-4-7-12-8-5-6-9(15(16)17)11-10(8)13-18(2,3)14-11/h5-6,12H,4,7H2,1-3H3 |
| InChIKey | CUCZEOYCTPNGRM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|