About N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-N'-(oxan-2-yloxy)octanediamide
N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-N'-(oxan-2-yloxy)octanediamide (PubChem CID 164771797) has the molecular formula C22H31BrN2O4
and a molecular weight of 467.40 g/mol. Its IUPAC name is N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-N'-(oxan-2-yloxy)octanediamide.
Molecular Properties
| Compound Name | N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-N'-(oxan-2-yloxy)octanediamide |
| PubChem CID | 164771797 |
| Molecular Formula | C22H31BrN2O4 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-N'-(oxan-2-yloxy)octanediamide |
| SMILES | O=C(CCCCCCC(=O)NC1CCc2cc(Br)ccc21)NOC1CCCCO1 |
| InChI | InChI=1S/C22H31BrN2O4/c23-17-11-12-18-16(15-17)10-13-19(18)24-20(26)7-3-1-2-4-8-21(27)25-29-22-9-5-6-14-28-22/h11-12,15,19,22H,1-10,13-14H2,(H,24,26)(H,25,27) |
| InChIKey | NNJVAPYHXQNGIC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-N'-(oxan-2-yloxy)octanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-N'-(oxan-2-yloxy)octanediamide?
The IUPAC name of N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-N'-(oxan-2-yloxy)octanediamide (CID 164771797) is N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-N'-(oxan-2-yloxy)octanediamide.
What is the SMILES notation for N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-N'-(oxan-2-yloxy)octanediamide?
The canonical SMILES for N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-N'-(oxan-2-yloxy)octanediamide is O=C(CCCCCCC(=O)NC1CCc2cc(Br)ccc21)NOC1CCCCO1.
What is the InChIKey of N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-N'-(oxan-2-yloxy)octanediamide?
The InChIKey is NNJVAPYHXQNGIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31BrN2O4/c23-17-11-12-18-16(15-17)10-13-19(18)24-20(26)7-3-1-2-4-8-21(27)25-29-22-9-5-6-14-28-22/h11-12,15,19,22H,1-10,13-14H2,(H,24,26)(H,25,27).
What are the key properties of N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-N'-(oxan-2-yloxy)octanediamide?
N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-N'-(oxan-2-yloxy)octanediamide has a molecular weight of 467.40 g/mol, XLogP of 4.47, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-N'-(oxan-2-yloxy)octanediamide is sourced from PubChem (CID 164771797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).