About carbanide;chlororuthenium(3+);N-methyl-N-[(E)-propan-2-ylideneamino]methanamine
carbanide;chlororuthenium(3+);N-methyl-N-[(E)-propan-2-ylideneamino]methanamine (PubChem CID 164773898) has the molecular formula C6H14ClN2Ru+
and a molecular weight of 250.71 g/mol. Its IUPAC name is carbanide;chlororuthenium(3+);N-methyl-N-[(E)-propan-2-ylideneamino]methanamine.
Molecular Properties
| Compound Name | carbanide;chlororuthenium(3+);N-methyl-N-[(E)-propan-2-ylideneamino]methanamine |
| PubChem CID | 164773898 |
| Molecular Formula | C6H14ClN2Ru+ |
| Molecular Weight | 250.71 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | carbanide;chlororuthenium(3+);N-methyl-N-[(E)-propan-2-ylideneamino]methanamine |
| SMILES | Cl[Ru+3].[CH2-]/C(C)=N\N(C)C.[CH3-] |
| InChI | InChI=1S/C5H11N2.CH3.ClH.Ru/c1-5(2)6-7(3)4;;;/h1H2,2-4H3;1H3;1H;/q2*-1;;+4/p-1/b6-5+;;; |
| InChIKey | ZONRSCQRXPJIPK-FWMLTEASSA-M |
| XLogP | 1.90 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.71 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carbanide;chlororuthenium(3+);N-methyl-N-[(E)-propan-2-ylideneamino]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;chlororuthenium(3+);N-methyl-N-[(E)-propan-2-ylideneamino]methanamine?
The IUPAC name of carbanide;chlororuthenium(3+);N-methyl-N-[(E)-propan-2-ylideneamino]methanamine (CID 164773898) is carbanide;chlororuthenium(3+);N-methyl-N-[(E)-propan-2-ylideneamino]methanamine.
What is the SMILES notation for carbanide;chlororuthenium(3+);N-methyl-N-[(E)-propan-2-ylideneamino]methanamine?
The canonical SMILES for carbanide;chlororuthenium(3+);N-methyl-N-[(E)-propan-2-ylideneamino]methanamine is Cl[Ru+3].[CH2-]/C(C)=N\N(C)C.[CH3-].
What is the InChIKey of carbanide;chlororuthenium(3+);N-methyl-N-[(E)-propan-2-ylideneamino]methanamine?
The InChIKey is ZONRSCQRXPJIPK-FWMLTEASSA-M. The full InChI is InChI=1S/C5H11N2.CH3.ClH.Ru/c1-5(2)6-7(3)4;;;/h1H2,2-4H3;1H3;1H;/q2*-1;;+4/p-1/b6-5+;;;.
What are the key properties of carbanide;chlororuthenium(3+);N-methyl-N-[(E)-propan-2-ylideneamino]methanamine?
carbanide;chlororuthenium(3+);N-methyl-N-[(E)-propan-2-ylideneamino]methanamine has a molecular weight of 250.71 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;chlororuthenium(3+);N-methyl-N-[(E)-propan-2-ylideneamino]methanamine is sourced from PubChem (CID 164773898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).