C19H24N2O4S — CID 164775610
[(1S,5R,12aS)-8-amino-5,12a-dimethyl-1,2,3,5,11,12-hexahydronaphtho[1,2-c]chromen-1-yl] sulfamate (PubChem CID 164775610) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is [(1S,5R,12aS)-8-amino-5,12a-dimethyl-1,2,3,5,11,12-hexahydronaphtho[1,2-c]chromen-1-yl] sulfamate.
| Compound Name | [(1S,5R,12aS)-8-amino-5,12a-dimethyl-1,2,3,5,11,12-hexahydronaphtho[1,2-c]chromen-1-yl] sulfamate |
|---|---|
| PubChem CID | 164775610 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | [(1S,5R,12aS)-8-amino-5,12a-dimethyl-1,2,3,5,11,12-hexahydronaphtho[1,2-c]chromen-1-yl] sulfamate |
| SMILES | C[C@H]1Oc2cc(N)ccc2C2=C1C1=CCC[C@H](OS(N)(=O)=O)[C@@]1(C)CC2 |
| InChI | InChI=1S/C19H24N2O4S/c1-11-18-14(13-7-6-12(20)10-16(13)24-11)8-9-19(2)15(18)4-3-5-17(19)25-26(21,22)23/h4,6-7,10-11,17H,3,5,8-9,20H2,1-2H3,(H2,21,22,23)/t11-,17+,19+/m1/s1 |
| InChIKey | IUFFIVNCLNURRD-RDBACFOTSA-N |
| XLogP | 2.91 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|