C25H25NS2 — CID 164775635
2-[9-(4-prop-2-enylphenyl)-6-(2-sulfanylethyl)carbazol-3-yl]ethanethiol (PubChem CID 164775635) has the molecular formula C25H25NS2 and a molecular weight of 403.62 g/mol. Its IUPAC name is 2-[9-(4-prop-2-enylphenyl)-6-(2-sulfanylethyl)carbazol-3-yl]ethanethiol.
| Compound Name | 2-[9-(4-prop-2-enylphenyl)-6-(2-sulfanylethyl)carbazol-3-yl]ethanethiol |
|---|---|
| PubChem CID | 164775635 |
| Molecular Formula | C25H25NS2 |
| Molecular Weight | 403.62 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 2-[9-(4-prop-2-enylphenyl)-6-(2-sulfanylethyl)carbazol-3-yl]ethanethiol |
| SMILES | C=CCc1ccc(-n2c3ccc(CCS)cc3c3cc(CCS)ccc32)cc1 |
| InChI | InChI=1S/C25H25NS2/c1-2-3-18-4-8-21(9-5-18)26-24-10-6-19(12-14-27)16-22(24)23-17-20(13-15-28)7-11-25(23)26/h2,4-11,16-17,27-28H,1,3,12-15H2 |
| InChIKey | AJZXMZCGJCZCCG-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 4.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.62 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|