C16H20N6O — CID 164775716
N-[2-(aminomethyl)phenyl]-6-methoxy-9-propan-2-ylpurin-2-amine (PubChem CID 164775716) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is N-[2-(aminomethyl)phenyl]-6-methoxy-9-propan-2-ylpurin-2-amine.
| Compound Name | N-[2-(aminomethyl)phenyl]-6-methoxy-9-propan-2-ylpurin-2-amine |
|---|---|
| PubChem CID | 164775716 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | N-[2-(aminomethyl)phenyl]-6-methoxy-9-propan-2-ylpurin-2-amine |
| SMILES | COc1nc(Nc2ccccc2CN)nc2c1ncn2C(C)C |
| InChI | InChI=1S/C16H20N6O/c1-10(2)22-9-18-13-14(22)20-16(21-15(13)23-3)19-12-7-5-4-6-11(12)8-17/h4-7,9-10H,8,17H2,1-3H3,(H,19,20,21) |
| InChIKey | BCEDGLQVQMHRHM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |