About N,N-dibenzyl-3,5-dichloro-4-[(6-methoxy-5-propan-2-yl-3-pyridinyl)methyl]aniline
N,N-dibenzyl-3,5-dichloro-4-[(6-methoxy-5-propan-2-yl-3-pyridinyl)methyl]aniline (PubChem CID 164775955) has the molecular formula C30H30Cl2N2O
and a molecular weight of 505.49 g/mol. Its IUPAC name is N,N-dibenzyl-3,5-dichloro-4-[(6-methoxy-5-propan-2-yl-3-pyridinyl)methyl]aniline.
Molecular Properties
| Compound Name | N,N-dibenzyl-3,5-dichloro-4-[(6-methoxy-5-propan-2-yl-3-pyridinyl)methyl]aniline |
| PubChem CID | 164775955 |
| Molecular Formula | C30H30Cl2N2O |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | N,N-dibenzyl-3,5-dichloro-4-[(6-methoxy-5-propan-2-yl-3-pyridinyl)methyl]aniline |
| SMILES | COc1ncc(Cc2c(Cl)cc(N(Cc3ccccc3)Cc3ccccc3)cc2Cl)cc1C(C)C |
| InChI | InChI=1S/C30H30Cl2N2O/c1-21(2)26-14-24(18-33-30(26)35-3)15-27-28(31)16-25(17-29(27)32)34(19-22-10-6-4-7-11-22)20-23-12-8-5-9-13-23/h4-14,16-18,21H,15,19-20H2,1-3H3 |
| InChIKey | SGPATXXGZYYBTD-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dibenzyl-3,5-dichloro-4-[(6-methoxy-5-propan-2-yl-3-pyridinyl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibenzyl-3,5-dichloro-4-[(6-methoxy-5-propan-2-yl-3-pyridinyl)methyl]aniline?
The IUPAC name of N,N-dibenzyl-3,5-dichloro-4-[(6-methoxy-5-propan-2-yl-3-pyridinyl)methyl]aniline (CID 164775955) is N,N-dibenzyl-3,5-dichloro-4-[(6-methoxy-5-propan-2-yl-3-pyridinyl)methyl]aniline.
What is the SMILES notation for N,N-dibenzyl-3,5-dichloro-4-[(6-methoxy-5-propan-2-yl-3-pyridinyl)methyl]aniline?
The canonical SMILES for N,N-dibenzyl-3,5-dichloro-4-[(6-methoxy-5-propan-2-yl-3-pyridinyl)methyl]aniline is COc1ncc(Cc2c(Cl)cc(N(Cc3ccccc3)Cc3ccccc3)cc2Cl)cc1C(C)C.
What is the InChIKey of N,N-dibenzyl-3,5-dichloro-4-[(6-methoxy-5-propan-2-yl-3-pyridinyl)methyl]aniline?
The InChIKey is SGPATXXGZYYBTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H30Cl2N2O/c1-21(2)26-14-24(18-33-30(26)35-3)15-27-28(31)16-25(17-29(27)32)34(19-22-10-6-4-7-11-22)20-23-12-8-5-9-13-23/h4-14,16-18,21H,15,19-20H2,1-3H3.
What are the key properties of N,N-dibenzyl-3,5-dichloro-4-[(6-methoxy-5-propan-2-yl-3-pyridinyl)methyl]aniline?
N,N-dibenzyl-3,5-dichloro-4-[(6-methoxy-5-propan-2-yl-3-pyridinyl)methyl]aniline has a molecular weight of 505.49 g/mol, XLogP of 8.32, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibenzyl-3,5-dichloro-4-[(6-methoxy-5-propan-2-yl-3-pyridinyl)methyl]aniline is sourced from PubChem (CID 164775955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).