C22H27FN4O9P2 — CID 164776422
[[(2R,3R,5R)-5-[4-[[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-6-methylpyrazolo[3,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 164776422) has the molecular formula C22H27FN4O9P2 and a molecular weight of 572.42 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-[4-[[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-6-methylpyrazolo[3,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3R,5R)-5-[4-[[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-6-methylpyrazolo[3,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 164776422 |
| Molecular Formula | C22H27FN4O9P2 |
| Molecular Weight | 572.42 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | [[(2R,3R,5R)-5-[4-[[(1R)-5-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-6-methylpyrazolo[3,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | Cc1cc(N[C@@H]2CCc3cc(F)ccc32)c2cnn([C@@H]3O[C@H](COP(=O)(O)CP(=O)(O)O)[C@H](O)C3O)c2n1 |
| InChI | InChI=1S/C22H27FN4O9P2/c1-11-6-17(26-16-5-2-12-7-13(23)3-4-14(12)16)15-8-24-27(21(15)25-11)22-20(29)19(28)18(36-22)9-35-38(33,34)10-37(30,31)32/h3-4,6-8,16,18-20,22,28-29H,2,5,9-10H2,1H3,(H,25,26)(H,33,34)(H2,30,31,32)/t16-,18-,19+,20?,22-/m1/s1 |
| InChIKey | PVRNHDOWYKQGBC-XZCGGAGZSA-N |
| XLogP | 1.93 |
| TPSA | 196.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|