C42H75NO4 — CID 164776891
[(2S)-4-(dimethylamino)-2-[(9Z,15Z)-octadeca-9,15-dienoyl]oxybutyl] (9Z,15Z)-octadeca-9,15-dienoate (PubChem CID 164776891) has the molecular formula C42H75NO4 and a molecular weight of 658.07 g/mol. Its IUPAC name is [(2S)-4-(dimethylamino)-2-[(9Z,15Z)-octadeca-9,15-dienoyl]oxybutyl] (9Z,15Z)-octadeca-9,15-dienoate.
| Compound Name | [(2S)-4-(dimethylamino)-2-[(9Z,15Z)-octadeca-9,15-dienoyl]oxybutyl] (9Z,15Z)-octadeca-9,15-dienoate |
|---|---|
| PubChem CID | 164776891 |
| Molecular Formula | C42H75NO4 |
| Molecular Weight | 658.07 g/mol |
| Exact Mass | 657.57 |
| IUPAC Name | [(2S)-4-(dimethylamino)-2-[(9Z,15Z)-octadeca-9,15-dienoyl]oxybutyl] (9Z,15Z)-octadeca-9,15-dienoate |
| SMILES | CC/C=C\CCCC/C=C\CCCCCCCC(=O)OC[C@H](CCN(C)C)OC(=O)CCCCCCC/C=C\CCCC/C=C\CC |
| InChI | InChI=1S/C42H75NO4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-41(44)46-39-40(37-38-43(3)4)47-42(45)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h7-10,19-22,40H,5-6,11-18,23-39H2,1-4H3/b9-7-,10-8-,21-19-,22-20-/t40-/m0/s1 |
| InChIKey | XKXYXFMSHIRVFR-DTLUIQGZSA-N |
| XLogP | 12.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.07 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|