About tert-butyl (2'S)-2'-carbamoyl-5-chloro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carboxylate
tert-butyl (2'S)-2'-carbamoyl-5-chloro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carboxylate (PubChem CID 164777025) has the molecular formula C17H20ClN3O4
and a molecular weight of 365.82 g/mol. Its IUPAC name is tert-butyl (2'S)-2'-carbamoyl-5-chloro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2'S)-2'-carbamoyl-5-chloro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carboxylate |
| PubChem CID | 164777025 |
| Molecular Formula | C17H20ClN3O4 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | tert-butyl (2'S)-2'-carbamoyl-5-chloro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(C[C@H]1C(N)=O)C(=O)Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C17H20ClN3O4/c1-16(2,3)25-15(24)21-8-17(7-12(21)13(19)22)10-6-9(18)4-5-11(10)20-14(17)23/h4-6,12H,7-8H2,1-3H3,(H2,19,22)(H,20,23)/t12-,17?/m0/s1 |
| InChIKey | VZXHYWVRCRYVKC-WHUIICBVSA-N |
| XLogP | 2.02 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (2'S)-2'-carbamoyl-5-chloro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2'S)-2'-carbamoyl-5-chloro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carboxylate?
The IUPAC name of tert-butyl (2'S)-2'-carbamoyl-5-chloro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carboxylate (CID 164777025) is tert-butyl (2'S)-2'-carbamoyl-5-chloro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carboxylate.
What is the SMILES notation for tert-butyl (2'S)-2'-carbamoyl-5-chloro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carboxylate?
The canonical SMILES for tert-butyl (2'S)-2'-carbamoyl-5-chloro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carboxylate is CC(C)(C)OC(=O)N1CC2(C[C@H]1C(N)=O)C(=O)Nc1ccc(Cl)cc12.
What is the InChIKey of tert-butyl (2'S)-2'-carbamoyl-5-chloro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carboxylate?
The InChIKey is VZXHYWVRCRYVKC-WHUIICBVSA-N. The full InChI is InChI=1S/C17H20ClN3O4/c1-16(2,3)25-15(24)21-8-17(7-12(21)13(19)22)10-6-9(18)4-5-11(10)20-14(17)23/h4-6,12H,7-8H2,1-3H3,(H2,19,22)(H,20,23)/t12-,17?/m0/s1.
What are the key properties of tert-butyl (2'S)-2'-carbamoyl-5-chloro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carboxylate?
tert-butyl (2'S)-2'-carbamoyl-5-chloro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carboxylate has a molecular weight of 365.82 g/mol, XLogP of 2.02, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2'S)-2'-carbamoyl-5-chloro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carboxylate is sourced from PubChem (CID 164777025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).