C28H28N2Se — CID 164777241
15-(3,5-dimethylphenyl)-5-(2,2-dimethylpropyl)-12-methyl-17-selena-13,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11,13,15-octaene (PubChem CID 164777241) has the molecular formula C28H28N2Se and a molecular weight of 471.51 g/mol. Its IUPAC name is 15-(3,5-dimethylphenyl)-5-(2,2-dimethylpropyl)-12-methyl-17-selena-13,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11,13,15-octaene.
| Compound Name | 15-(3,5-dimethylphenyl)-5-(2,2-dimethylpropyl)-12-methyl-17-selena-13,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11,13,15-octaene |
|---|---|
| PubChem CID | 164777241 |
| Molecular Formula | C28H28N2Se |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 15-(3,5-dimethylphenyl)-5-(2,2-dimethylpropyl)-12-methyl-17-selena-13,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11,13,15-octaene |
| SMILES | Cc1cc(C)cc(-c2nnc(C)c3c2[se]c2c4ccc(CC(C)(C)C)cc4ccc23)c1 |
| InChI | InChI=1S/C28H28N2Se/c1-16-11-17(2)13-21(12-16)25-27-24(18(3)29-30-25)23-10-8-20-14-19(15-28(4,5)6)7-9-22(20)26(23)31-27/h7-14H,15H2,1-6H3 |
| InChIKey | ZAPQVLXJXGWJCW-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|