About 2-tert-butyl-3,5-dimethyl-1-benzoselenophene
2-tert-butyl-3,5-dimethyl-1-benzoselenophene (PubChem CID 164777343) has the molecular formula C14H18Se
and a molecular weight of 265.26 g/mol. Its IUPAC name is 2-tert-butyl-3,5-dimethyl-1-benzoselenophene.
Molecular Properties
| Compound Name | 2-tert-butyl-3,5-dimethyl-1-benzoselenophene |
| PubChem CID | 164777343 |
| Molecular Formula | C14H18Se |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-tert-butyl-3,5-dimethyl-1-benzoselenophene |
| SMILES | Cc1ccc2[se]c(C(C)(C)C)c(C)c2c1 |
| InChI | InChI=1S/C14H18Se/c1-9-6-7-12-11(8-9)10(2)13(15-12)14(3,4)5/h6-8H,1-5H3 |
| InChIKey | LQKDBSKQAZLYCP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-3,5-dimethyl-1-benzoselenophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3,5-dimethyl-1-benzoselenophene?
The IUPAC name of 2-tert-butyl-3,5-dimethyl-1-benzoselenophene (CID 164777343) is 2-tert-butyl-3,5-dimethyl-1-benzoselenophene.
What is the SMILES notation for 2-tert-butyl-3,5-dimethyl-1-benzoselenophene?
The canonical SMILES for 2-tert-butyl-3,5-dimethyl-1-benzoselenophene is Cc1ccc2[se]c(C(C)(C)C)c(C)c2c1.
What is the InChIKey of 2-tert-butyl-3,5-dimethyl-1-benzoselenophene?
The InChIKey is LQKDBSKQAZLYCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18Se/c1-9-6-7-12-11(8-9)10(2)13(15-12)14(3,4)5/h6-8H,1-5H3.
What are the key properties of 2-tert-butyl-3,5-dimethyl-1-benzoselenophene?
2-tert-butyl-3,5-dimethyl-1-benzoselenophene has a molecular weight of 265.26 g/mol, XLogP of 3.81, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3,5-dimethyl-1-benzoselenophene is sourced from PubChem (CID 164777343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).