C9H9F2O7S- — CID 164777716
2-(3,8-dioxatricyclo[3.2.1.02,4]octane-6-carbonyloxy)-1,1-difluoroethanesulfonate (PubChem CID 164777716) has the molecular formula C9H9F2O7S- and a molecular weight of 299.23 g/mol. Its IUPAC name is 2-(3,8-dioxatricyclo[3.2.1.02,4]octane-6-carbonyloxy)-1,1-difluoroethanesulfonate.
| Compound Name | 2-(3,8-dioxatricyclo[3.2.1.02,4]octane-6-carbonyloxy)-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 164777716 |
| Molecular Formula | C9H9F2O7S- |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 2-(3,8-dioxatricyclo[3.2.1.02,4]octane-6-carbonyloxy)-1,1-difluoroethanesulfonate |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)[O-])C1CC2OC1C1OC21 |
| InChI | InChI=1S/C9H10F2O7S/c10-9(11,19(13,14)15)2-16-8(12)3-1-4-6-7(18-6)5(3)17-4/h3-7H,1-2H2,(H,13,14,15)/p-1 |
| InChIKey | HCXRZRRPOUAEOH-UHFFFAOYSA-M |
| XLogP | -0.78 |
| TPSA | 105.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|