C17H12F5O7S- — CID 164777737
1,1,3,3,3-pentafluoro-2-[4-(oxiran-2-ylmethoxy)naphthalene-1-carbonyl]oxypropane-1-sulfonate (PubChem CID 164777737) has the molecular formula C17H12F5O7S- and a molecular weight of 455.33 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-[4-(oxiran-2-ylmethoxy)naphthalene-1-carbonyl]oxypropane-1-sulfonate.
| Compound Name | 1,1,3,3,3-pentafluoro-2-[4-(oxiran-2-ylmethoxy)naphthalene-1-carbonyl]oxypropane-1-sulfonate |
|---|---|
| PubChem CID | 164777737 |
| Molecular Formula | C17H12F5O7S- |
| Molecular Weight | 455.33 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-[4-(oxiran-2-ylmethoxy)naphthalene-1-carbonyl]oxypropane-1-sulfonate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])c1ccc(OCC2CO2)c2ccccc12 |
| InChI | InChI=1S/C17H13F5O7S/c18-16(19,20)15(17(21,22)30(24,25)26)29-14(23)12-5-6-13(28-8-9-7-27-9)11-4-2-1-3-10(11)12/h1-6,9,15H,7-8H2,(H,24,25,26)/p-1 |
| InChIKey | VNUYSIGHAYNZCD-UHFFFAOYSA-M |
| XLogP | 2.84 |
| TPSA | 105.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|