About 1-(oxiran-2-yl)pyrrole-2,5-dione
1-(oxiran-2-yl)pyrrole-2,5-dione (PubChem CID 164778847) has the molecular formula C6H5NO3
and a molecular weight of 139.11 g/mol. Its IUPAC name is 1-(oxiran-2-yl)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-(oxiran-2-yl)pyrrole-2,5-dione |
| PubChem CID | 164778847 |
| Molecular Formula | C6H5NO3 |
| Molecular Weight | 139.11 g/mol |
| Exact Mass | 139.03 |
| IUPAC Name | 1-(oxiran-2-yl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1C1CO1 |
| InChI | InChI=1S/C6H5NO3/c8-4-1-2-5(9)7(4)6-3-10-6/h1-2,6H,3H2 |
| InChIKey | FGJIXAWJULXLSX-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.11 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-(oxiran-2-yl)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxiran-2-yl)pyrrole-2,5-dione?
The IUPAC name of 1-(oxiran-2-yl)pyrrole-2,5-dione (CID 164778847) is 1-(oxiran-2-yl)pyrrole-2,5-dione.
What is the SMILES notation for 1-(oxiran-2-yl)pyrrole-2,5-dione?
The canonical SMILES for 1-(oxiran-2-yl)pyrrole-2,5-dione is O=C1C=CC(=O)N1C1CO1.
What is the InChIKey of 1-(oxiran-2-yl)pyrrole-2,5-dione?
The InChIKey is FGJIXAWJULXLSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO3/c8-4-1-2-5(9)7(4)6-3-10-6/h1-2,6H,3H2.
What are the key properties of 1-(oxiran-2-yl)pyrrole-2,5-dione?
1-(oxiran-2-yl)pyrrole-2,5-dione has a molecular weight of 139.11 g/mol, XLogP of -0.73, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxiran-2-yl)pyrrole-2,5-dione is sourced from PubChem (CID 164778847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).