C66H48BN5OPt-2 — CID 164779037
CID 164779037 (PubChem CID 164779037) has the molecular formula C66H48BN5OPt-2 and a molecular weight of 1149.13 g/mol.
| Compound Name | CID 164779037 |
|---|---|
| PubChem CID | 164779037 |
| Molecular Formula | C66H48BN5OPt-2 |
| Molecular Weight | 1149.13 g/mol |
| Exact Mass | 1148.46 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2-[n+]2[c-]n3c4c5c(ccc42)c2ccccc2n5B(c2c(C([2H])([2H])[2H])cccc2C([2H])([2H])[2H])c2ccc(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)C)ccn4)[c-]c2-3)c([2H])c1[2H].[Pt] |
| InChI | InChI=1S/C66H48BN5O.Pt/c1-42-18-16-19-43(2)62(42)67-55-34-31-48(73-47-30-32-53-51-24-12-14-28-56(51)71(59(53)39-47)61-38-46(36-37-68-61)66(3,4)5)40-60(55)70-41-69(58-35-33-54-52-25-13-15-29-57(52)72(67)64(54)65(58)70)63-49(44-20-8-6-9-21-44)26-17-27-50(63)45-22-10-7-11-23-45;/h6-38H,1-5H3;/q-2;/i1D3,2D3,6D,7D,8D,9D,10D,11D,20D,21D,22D,23D; |
| InChIKey | FVPDRRUXHCTZOY-MUNZVCNLSA-N |
| XLogP | 13.91 |
| TPSA | 40.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1149.13 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|