About 2-tert-butyl-1,6-dihydropyrene
2-tert-butyl-1,6-dihydropyrene (PubChem CID 164779934) has the molecular formula C20H20
and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-tert-butyl-1,6-dihydropyrene.
Molecular Properties
| Compound Name | 2-tert-butyl-1,6-dihydropyrene |
| PubChem CID | 164779934 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-tert-butyl-1,6-dihydropyrene |
| SMILES | CC(C)(C)C1=Cc2ccc3c4c(ccc(c24)C1)C=CC3 |
| InChI | InChI=1S/C20H20/c1-20(2,3)17-11-15-9-7-13-5-4-6-14-8-10-16(12-17)19(15)18(13)14/h4-5,7-10,12H,6,11H2,1-3H3 |
| InChIKey | TWLKFDWPJWJCRI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-tert-butyl-1,6-dihydropyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1,6-dihydropyrene?
The IUPAC name of 2-tert-butyl-1,6-dihydropyrene (CID 164779934) is 2-tert-butyl-1,6-dihydropyrene.
What is the SMILES notation for 2-tert-butyl-1,6-dihydropyrene?
The canonical SMILES for 2-tert-butyl-1,6-dihydropyrene is CC(C)(C)C1=Cc2ccc3c4c(ccc(c24)C1)C=CC3.
What is the InChIKey of 2-tert-butyl-1,6-dihydropyrene?
The InChIKey is TWLKFDWPJWJCRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20/c1-20(2,3)17-11-15-9-7-13-5-4-6-14-8-10-16(12-17)19(15)18(13)14/h4-5,7-10,12H,6,11H2,1-3H3.
What are the key properties of 2-tert-butyl-1,6-dihydropyrene?
2-tert-butyl-1,6-dihydropyrene has a molecular weight of 260.38 g/mol, XLogP of 5.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1,6-dihydropyrene is sourced from PubChem (CID 164779934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).